C34H48O10 — CID 54173101
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxan-2-yl]methyl acetate (PubChem CID 54173101) has the molecular formula C34H48O10 and a molecular weight of 616.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54173101 |
| Molecular Formula | C34H48O10 |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC=C(C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H48O10/c1-21(15-16-28-23(3)14-11-18-34(28,8)9)12-10-13-22(2)17-19-39-33-32(43-27(7)38)31(42-26(6)37)30(41-25(5)36)29(44-33)20-40-24(4)35/h10,12-13,15-17,29-33H,11,14,18-20H2,1-9H3/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | OWJZMUDNTTYSCN-IZDBAANZSA-N |
| XLogP | 5.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|