About 2-(methylsulfinylmethyl)-1,4-dioxane
2-(methylsulfinylmethyl)-1,4-dioxane (PubChem CID 54173466) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-(methylsulfinylmethyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(methylsulfinylmethyl)-1,4-dioxane |
| PubChem CID | 54173466 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-(methylsulfinylmethyl)-1,4-dioxane |
| SMILES | CS(=O)CC1COCCO1 |
| InChI | InChI=1S/C6H12O3S/c1-10(7)5-6-4-8-2-3-9-6/h6H,2-5H2,1H3 |
| InChIKey | OWPWBIFUCGFBMQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methylsulfinylmethyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylsulfinylmethyl)-1,4-dioxane?
The IUPAC name of 2-(methylsulfinylmethyl)-1,4-dioxane (CID 54173466) is 2-(methylsulfinylmethyl)-1,4-dioxane.
What is the SMILES notation for 2-(methylsulfinylmethyl)-1,4-dioxane?
The canonical SMILES for 2-(methylsulfinylmethyl)-1,4-dioxane is CS(=O)CC1COCCO1.
What is the InChIKey of 2-(methylsulfinylmethyl)-1,4-dioxane?
The InChIKey is OWPWBIFUCGFBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c1-10(7)5-6-4-8-2-3-9-6/h6H,2-5H2,1H3.
What are the key properties of 2-(methylsulfinylmethyl)-1,4-dioxane?
2-(methylsulfinylmethyl)-1,4-dioxane has a molecular weight of 164.23 g/mol, XLogP of -0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylsulfinylmethyl)-1,4-dioxane is sourced from PubChem (CID 54173466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).