About 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide
3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide (PubChem CID 54173706) has the molecular formula C22H15NO7
and a molecular weight of 405.36 g/mol. Its IUPAC name is 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide.
Molecular Properties
| Compound Name | 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide |
| PubChem CID | 54173706 |
| Molecular Formula | C22H15NO7 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide |
| SMILES | NC(=O)c1c(CO)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15NO7/c23-20(27)18-10(9-24)1-4-15-19(18)21(28)30-22(15)13-5-2-11(25)7-16(13)29-17-8-12(26)3-6-14(17)22/h1-8,24-26H,9H2,(H2,23,27) |
| InChIKey | OWTWVTSHRSRZGQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide?
The IUPAC name of 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide (CID 54173706) is 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide.
What is the SMILES notation for 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide?
The canonical SMILES for 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide is NC(=O)c1c(CO)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide?
The InChIKey is OWTWVTSHRSRZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO7/c23-20(27)18-10(9-24)1-4-15-19(18)21(28)30-22(15)13-5-2-11(25)7-16(13)29-17-8-12(26)3-6-14(17)22/h1-8,24-26H,9H2,(H2,23,27).
What are the key properties of 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide?
3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide has a molecular weight of 405.36 g/mol, XLogP of 2.26, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3',6'-dihydroxy-5-(hydroxymethyl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxamide is sourced from PubChem (CID 54173706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).