About 2-(4,5-dihydroimidazol-1-yl)propan-1-ol
2-(4,5-dihydroimidazol-1-yl)propan-1-ol (PubChem CID 54174149) has the molecular formula C6H12N2O
and a molecular weight of 128.18 g/mol. Its IUPAC name is 2-(4,5-dihydroimidazol-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-(4,5-dihydroimidazol-1-yl)propan-1-ol |
| PubChem CID | 54174149 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-(4,5-dihydroimidazol-1-yl)propan-1-ol |
| SMILES | CC(CO)N1C=NCC1 |
| InChI | InChI=1S/C6H12N2O/c1-6(4-9)8-3-2-7-5-8/h5-6,9H,2-4H2,1H3 |
| InChIKey | OXBPHINWIUDBAD-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydroimidazol-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydroimidazol-1-yl)propan-1-ol?
The IUPAC name of 2-(4,5-dihydroimidazol-1-yl)propan-1-ol (CID 54174149) is 2-(4,5-dihydroimidazol-1-yl)propan-1-ol.
What is the SMILES notation for 2-(4,5-dihydroimidazol-1-yl)propan-1-ol?
The canonical SMILES for 2-(4,5-dihydroimidazol-1-yl)propan-1-ol is CC(CO)N1C=NCC1.
What is the InChIKey of 2-(4,5-dihydroimidazol-1-yl)propan-1-ol?
The InChIKey is OXBPHINWIUDBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-6(4-9)8-3-2-7-5-8/h5-6,9H,2-4H2,1H3.
What are the key properties of 2-(4,5-dihydroimidazol-1-yl)propan-1-ol?
2-(4,5-dihydroimidazol-1-yl)propan-1-ol has a molecular weight of 128.18 g/mol, XLogP of -0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydroimidazol-1-yl)propan-1-ol is sourced from PubChem (CID 54174149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).