C11H16N2O6 — CID 54174189
[(3R,4R,5S)-4,5-diacetyloxy-6-amino-2,3,4,5-tetrahydropyridin-3-yl] acetate (PubChem CID 54174189) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is [(3R,4R,5S)-4,5-diacetyloxy-6-amino-2,3,4,5-tetrahydropyridin-3-yl] acetate.
| Compound Name | [(3R,4R,5S)-4,5-diacetyloxy-6-amino-2,3,4,5-tetrahydropyridin-3-yl] acetate |
|---|---|
| PubChem CID | 54174189 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [(3R,4R,5S)-4,5-diacetyloxy-6-amino-2,3,4,5-tetrahydropyridin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)CN=C(N)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H16N2O6/c1-5(14)17-8-4-13-11(12)10(19-7(3)16)9(8)18-6(2)15/h8-10H,4H2,1-3H3,(H2,12,13)/t8-,9-,10-/m1/s1 |
| InChIKey | OXCBJTYIFROVCU-OPRDCNLKSA-N |
| XLogP | -0.85 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|