C12H12BrF3O2 — CID 54174415
(3R,4S)-3-bromo-2,2-dimethyl-7-(trifluoromethyl)-3,4-dihydrochromen-4-ol (PubChem CID 54174415) has the molecular formula C12H12BrF3O2 and a molecular weight of 325.12 g/mol. Its IUPAC name is (3R,4S)-3-bromo-2,2-dimethyl-7-(trifluoromethyl)-3,4-dihydrochromen-4-ol.
| Compound Name | (3R,4S)-3-bromo-2,2-dimethyl-7-(trifluoromethyl)-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 54174415 |
| Molecular Formula | C12H12BrF3O2 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | (3R,4S)-3-bromo-2,2-dimethyl-7-(trifluoromethyl)-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)Oc2cc(C(F)(F)F)ccc2[C@H](O)[C@H]1Br |
| InChI | InChI=1S/C12H12BrF3O2/c1-11(2)10(13)9(17)7-4-3-6(12(14,15)16)5-8(7)18-11/h3-5,9-10,17H,1-2H3/t9-,10+/m0/s1 |
| InChIKey | OXGDPOFZHVCEQX-VHSXEESVSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|