C6H9F3O4S — CID 54174706
(4S,5R)-1,1,1-trifluoro-2,4,5-trihydroxy-6-sulfanylhexan-3-one (PubChem CID 54174706) has the molecular formula C6H9F3O4S and a molecular weight of 234.19 g/mol. Its IUPAC name is (4S,5R)-1,1,1-trifluoro-2,4,5-trihydroxy-6-sulfanylhexan-3-one.
| Compound Name | (4S,5R)-1,1,1-trifluoro-2,4,5-trihydroxy-6-sulfanylhexan-3-one |
|---|---|
| PubChem CID | 54174706 |
| Molecular Formula | C6H9F3O4S |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | (4S,5R)-1,1,1-trifluoro-2,4,5-trihydroxy-6-sulfanylhexan-3-one |
| SMILES | O=C(C(O)C(F)(F)F)[C@@H](O)[C@@H](O)CS |
| InChI | InChI=1S/C6H9F3O4S/c7-6(8,9)5(13)4(12)3(11)2(10)1-14/h2-3,5,10-11,13-14H,1H2/t2-,3-,5?/m0/s1 |
| InChIKey | OXLQLXVSUVJIJH-YCZCMMEYSA-N |
| XLogP | -0.87 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|