About ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate
ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate (PubChem CID 54174806) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate |
| PubChem CID | 54174806 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)/C=N/c1c(C)cccc1C |
| InChI | InChI=1S/C15H17N3O3/c1-4-21-15(20)18-14(19)12(8-16)9-17-13-10(2)6-5-7-11(13)3/h5-7,9,12H,4H2,1-3H3,(H,18,19,20)/b17-9+ |
| InChIKey | OXNUDZNEFMNJTN-RQZCQDPDSA-N |
| XLogP | 2.42 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate?
The IUPAC name of ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate (CID 54174806) is ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate.
What is the SMILES notation for ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate?
The canonical SMILES for ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate is CCOC(=O)NC(=O)C(C#N)/C=N/c1c(C)cccc1C.
What is the InChIKey of ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate?
The InChIKey is OXNUDZNEFMNJTN-RQZCQDPDSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-4-21-15(20)18-14(19)12(8-16)9-17-13-10(2)6-5-7-11(13)3/h5-7,9,12H,4H2,1-3H3,(H,18,19,20)/b17-9+.
What are the key properties of ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate?
ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate has a molecular weight of 287.32 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-cyano-3-(2,6-dimethylphenyl)iminopropanoyl]carbamate is sourced from PubChem (CID 54174806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).