About 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione
1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione (PubChem CID 54174825) has the molecular formula C8H9ClF2O3
and a molecular weight of 226.61 g/mol. Its IUPAC name is 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione.
Molecular Properties
| Compound Name | 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione |
| PubChem CID | 54174825 |
| Molecular Formula | C8H9ClF2O3 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione |
| SMILES | CCOC=C(C(C)=O)C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C8H9ClF2O3/c1-3-14-4-6(5(2)12)7(13)8(9,10)11/h4H,3H2,1-2H3 |
| InChIKey | OXOAXTGYKYPNJM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione?
The IUPAC name of 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione (CID 54174825) is 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione.
What is the SMILES notation for 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione?
The canonical SMILES for 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione is CCOC=C(C(C)=O)C(=O)C(F)(F)Cl.
What is the InChIKey of 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione?
The InChIKey is OXOAXTGYKYPNJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF2O3/c1-3-14-4-6(5(2)12)7(13)8(9,10)11/h4H,3H2,1-2H3.
What are the key properties of 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione?
1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione has a molecular weight of 226.61 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(ethoxymethylidene)-1,1-difluoropentane-2,4-dione is sourced from PubChem (CID 54174825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).