About 2-(6-methylhepta-2,5-dien-2-yl)oxirene
2-(6-methylhepta-2,5-dien-2-yl)oxirene (PubChem CID 54175100) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(6-methylhepta-2,5-dien-2-yl)oxirene.
Molecular Properties
| Compound Name | 2-(6-methylhepta-2,5-dien-2-yl)oxirene |
| PubChem CID | 54175100 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(6-methylhepta-2,5-dien-2-yl)oxirene |
| SMILES | CC(C)=CCC=C(C)C1=CO1 |
| InChI | InChI=1S/C10H14O/c1-8(2)5-4-6-9(3)10-7-11-10/h5-7H,4H2,1-3H3 |
| InChIKey | OXSVSCUKFLMJQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methylhepta-2,5-dien-2-yl)oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylhepta-2,5-dien-2-yl)oxirene?
The IUPAC name of 2-(6-methylhepta-2,5-dien-2-yl)oxirene (CID 54175100) is 2-(6-methylhepta-2,5-dien-2-yl)oxirene.
What is the SMILES notation for 2-(6-methylhepta-2,5-dien-2-yl)oxirene?
The canonical SMILES for 2-(6-methylhepta-2,5-dien-2-yl)oxirene is CC(C)=CCC=C(C)C1=CO1.
What is the InChIKey of 2-(6-methylhepta-2,5-dien-2-yl)oxirene?
The InChIKey is OXSVSCUKFLMJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-8(2)5-4-6-9(3)10-7-11-10/h5-7H,4H2,1-3H3.
What are the key properties of 2-(6-methylhepta-2,5-dien-2-yl)oxirene?
2-(6-methylhepta-2,5-dien-2-yl)oxirene has a molecular weight of 150.22 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylhepta-2,5-dien-2-yl)oxirene is sourced from PubChem (CID 54175100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).