C19H17BrFNO4 — CID 54175177
(4S,5R)-3-[(2S,3R)-2-bromo-3-(4-fluorophenyl)-3-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 54175177) has the molecular formula C19H17BrFNO4 and a molecular weight of 422.25 g/mol. Its IUPAC name is (4S,5R)-3-[(2S,3R)-2-bromo-3-(4-fluorophenyl)-3-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2S,3R)-2-bromo-3-(4-fluorophenyl)-3-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54175177 |
| Molecular Formula | C19H17BrFNO4 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (4S,5R)-3-[(2S,3R)-2-bromo-3-(4-fluorophenyl)-3-hydroxypropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)N1C(=O)[C@@H](Br)[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17BrFNO4/c1-11-17(13-5-3-2-4-6-13)26-19(25)22(11)18(24)15(20)16(23)12-7-9-14(21)10-8-12/h2-11,15-17,23H,1H3/t11-,15-,16+,17-/m0/s1 |
| InChIKey | OXUKPLQRGUUMBF-UQCMEYCASA-N |
| XLogP | 3.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|