About 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine
1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine (PubChem CID 54175465) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine |
| PubChem CID | 54175465 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine |
| SMILES | CC1=CN(CCCCCN2C=C(C)C=C(C)C2)CC(C)=C1 |
| InChI | InChI=1S/C19H30N2/c1-16-10-17(2)13-20(12-16)8-6-5-7-9-21-14-18(3)11-19(4)15-21/h10-12,14H,5-9,13,15H2,1-4H3 |
| InChIKey | OXZZAJUZTOBHMV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine?
The IUPAC name of 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine (CID 54175465) is 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine.
What is the SMILES notation for 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine?
The canonical SMILES for 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine is CC1=CN(CCCCCN2C=C(C)C=C(C)C2)CC(C)=C1.
What is the InChIKey of 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine?
The InChIKey is OXZZAJUZTOBHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-16-10-17(2)13-20(12-16)8-6-5-7-9-21-14-18(3)11-19(4)15-21/h10-12,14H,5-9,13,15H2,1-4H3.
What are the key properties of 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine?
1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine has a molecular weight of 286.46 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,5-dimethyl-2H-pyridin-1-yl)pentyl]-3,5-dimethyl-2H-pyridine is sourced from PubChem (CID 54175465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).