C18H30F10N2S — CID 54175511
5,5,6,6,6-pentafluoro-N-methyl-4-[2-[6-(methylamino)-3-(1,1,2,2,2-pentafluoroethyl)hexyl]sulfanylethyl]hexan-1-amine (PubChem CID 54175511) has the molecular formula C18H30F10N2S and a molecular weight of 496.50 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-N-methyl-4-[2-[6-(methylamino)-3-(1,1,2,2,2-pentafluoroethyl)hexyl]sulfanylethyl]hexan-1-amine.
| Compound Name | 5,5,6,6,6-pentafluoro-N-methyl-4-[2-[6-(methylamino)-3-(1,1,2,2,2-pentafluoroethyl)hexyl]sulfanylethyl]hexan-1-amine |
|---|---|
| PubChem CID | 54175511 |
| Molecular Formula | C18H30F10N2S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-N-methyl-4-[2-[6-(methylamino)-3-(1,1,2,2,2-pentafluoroethyl)hexyl]sulfanylethyl]hexan-1-amine |
| SMILES | CNCCCC(CCSCCC(CCCNC)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H30F10N2S/c1-29-9-3-5-13(15(19,20)17(23,24)25)7-11-31-12-8-14(6-4-10-30-2)16(21,22)18(26,27)28/h13-14,29-30H,3-12H2,1-2H3 |
| InChIKey | OYBAPHRHLOIADF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|