About 2-(methylamino)naphthalene-1,4,5,8-tetrol
2-(methylamino)naphthalene-1,4,5,8-tetrol (PubChem CID 54175633) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(methylamino)naphthalene-1,4,5,8-tetrol.
Molecular Properties
| Compound Name | 2-(methylamino)naphthalene-1,4,5,8-tetrol |
| PubChem CID | 54175633 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(methylamino)naphthalene-1,4,5,8-tetrol |
| SMILES | CNc1cc(O)c2c(O)ccc(O)c2c1O |
| InChI | InChI=1S/C11H11NO4/c1-12-5-4-8(15)9-6(13)2-3-7(14)10(9)11(5)16/h2-4,12-16H,1H3 |
| InChIKey | OYDIQABFOHJCKS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)naphthalene-1,4,5,8-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)naphthalene-1,4,5,8-tetrol?
The IUPAC name of 2-(methylamino)naphthalene-1,4,5,8-tetrol (CID 54175633) is 2-(methylamino)naphthalene-1,4,5,8-tetrol.
What is the SMILES notation for 2-(methylamino)naphthalene-1,4,5,8-tetrol?
The canonical SMILES for 2-(methylamino)naphthalene-1,4,5,8-tetrol is CNc1cc(O)c2c(O)ccc(O)c2c1O.
What is the InChIKey of 2-(methylamino)naphthalene-1,4,5,8-tetrol?
The InChIKey is OYDIQABFOHJCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-12-5-4-8(15)9-6(13)2-3-7(14)10(9)11(5)16/h2-4,12-16H,1H3.
What are the key properties of 2-(methylamino)naphthalene-1,4,5,8-tetrol?
2-(methylamino)naphthalene-1,4,5,8-tetrol has a molecular weight of 221.21 g/mol, XLogP of 1.70, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)naphthalene-1,4,5,8-tetrol is sourced from PubChem (CID 54175633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).