C24H33N3O6 — CID 54176051
diethyl 2,6-dimethyl-1-(2-morpholin-4-ylethyl)-4-(1-oxidopyridin-1-ium-3-yl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 54176051) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-1-(2-morpholin-4-ylethyl)-4-(1-oxidopyridin-1-ium-3-yl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-1-(2-morpholin-4-ylethyl)-4-(1-oxidopyridin-1-ium-3-yl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54176051 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | diethyl 2,6-dimethyl-1-(2-morpholin-4-ylethyl)-4-(1-oxidopyridin-1-ium-3-yl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CCN2CCOCC2)C(C)=C(C(=O)OCC)C1c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C24H33N3O6/c1-5-32-23(28)20-17(3)27(11-10-25-12-14-31-15-13-25)18(4)21(24(29)33-6-2)22(20)19-8-7-9-26(30)16-19/h7-9,16,22H,5-6,10-15H2,1-4H3 |
| InChIKey | OYLDCMUZQFGPJB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|