C21H23NO2 — CID 54176266
2-phenyl-N-(2,2,7-trimethylchromen-6-yl)propanamide (PubChem CID 54176266) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-phenyl-N-(2,2,7-trimethylchromen-6-yl)propanamide.
| Compound Name | 2-phenyl-N-(2,2,7-trimethylchromen-6-yl)propanamide |
|---|---|
| PubChem CID | 54176266 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-phenyl-N-(2,2,7-trimethylchromen-6-yl)propanamide |
| SMILES | Cc1cc2c(cc1NC(=O)C(C)c1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C21H23NO2/c1-14-12-19-17(10-11-21(3,4)24-19)13-18(14)22-20(23)15(2)16-8-6-5-7-9-16/h5-13,15H,1-4H3,(H,22,23) |
| InChIKey | OYOQUYSINBJYFN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |