C16H24O7 — CID 54176851
2-[2-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 54176851) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[2-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 54176851 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[2-(3,7-dimethylocta-1,6-dien-3-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24O7/c1-5-15(4,8-6-7-11(2)3)23-13(19)10-16(22,14(20)21)9-12(17)18/h5,7,22H,1,6,8-10H2,2-4H3,(H,17,18)(H,20,21) |
| InChIKey | OYZQTPGGTUFMAS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|