About 2-methyl-4-oxohexa-2,5-dienamide
2-methyl-4-oxohexa-2,5-dienamide (PubChem CID 54176920) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-methyl-4-oxohexa-2,5-dienamide.
Molecular Properties
| Compound Name | 2-methyl-4-oxohexa-2,5-dienamide |
| PubChem CID | 54176920 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-methyl-4-oxohexa-2,5-dienamide |
| SMILES | C=CC(=O)C=C(C)C(N)=O |
| InChI | InChI=1S/C7H9NO2/c1-3-6(9)4-5(2)7(8)10/h3-4H,1H2,2H3,(H2,8,10) |
| InChIKey | OZAQWAFAQAXJBP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-oxohexa-2,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-oxohexa-2,5-dienamide?
The IUPAC name of 2-methyl-4-oxohexa-2,5-dienamide (CID 54176920) is 2-methyl-4-oxohexa-2,5-dienamide.
What is the SMILES notation for 2-methyl-4-oxohexa-2,5-dienamide?
The canonical SMILES for 2-methyl-4-oxohexa-2,5-dienamide is C=CC(=O)C=C(C)C(N)=O.
What is the InChIKey of 2-methyl-4-oxohexa-2,5-dienamide?
The InChIKey is OZAQWAFAQAXJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-6(9)4-5(2)7(8)10/h3-4H,1H2,2H3,(H2,8,10).
What are the key properties of 2-methyl-4-oxohexa-2,5-dienamide?
2-methyl-4-oxohexa-2,5-dienamide has a molecular weight of 139.15 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-oxohexa-2,5-dienamide is sourced from PubChem (CID 54176920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).