C13H14N2O2 — CID 54177302
5-benzyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-diol (PubChem CID 54177302) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-benzyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-diol.
| Compound Name | 5-benzyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-diol |
|---|---|
| PubChem CID | 54177302 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5-benzyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-diol |
| SMILES | Oc1c2c(c(O)n1Cc1ccccc1)CNC2 |
| InChI | InChI=1S/C13H14N2O2/c16-12-10-6-14-7-11(10)13(17)15(12)8-9-4-2-1-3-5-9/h1-5,14,16-17H,6-8H2 |
| InChIKey | OZHLADOZOYCXEU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |