C17H18ClF3N4O — CID 54177319
2-[(2-butoxy-5-methylphenyl)methyl]-7-chloro-6-(trifluoromethyl)-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 54177319) has the molecular formula C17H18ClF3N4O and a molecular weight of 386.81 g/mol. Its IUPAC name is 2-[(2-butoxy-5-methylphenyl)methyl]-7-chloro-6-(trifluoromethyl)-5H-pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2-[(2-butoxy-5-methylphenyl)methyl]-7-chloro-6-(trifluoromethyl)-5H-pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 54177319 |
| Molecular Formula | C17H18ClF3N4O |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[(2-butoxy-5-methylphenyl)methyl]-7-chloro-6-(trifluoromethyl)-5H-pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCCCOc1ccc(C)cc1Cc1nc2c(Cl)c(C(F)(F)F)[nH]n2n1 |
| InChI | InChI=1S/C17H18ClF3N4O/c1-3-4-7-26-12-6-5-10(2)8-11(12)9-13-22-16-14(18)15(17(19,20)21)24-25(16)23-13/h5-6,8,24H,3-4,7,9H2,1-2H3 |
| InChIKey | FNAWBAIUJYOIKL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|