C29H31NO2 — CID 54177431
(3R)-1-[2-(4-methoxyphenyl)ethyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyloxy)piperidine (PubChem CID 54177431) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3R)-1-[2-(4-methoxyphenyl)ethyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyloxy)piperidine.
| Compound Name | (3R)-1-[2-(4-methoxyphenyl)ethyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyloxy)piperidine |
|---|---|
| PubChem CID | 54177431 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (3R)-1-[2-(4-methoxyphenyl)ethyl]-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyloxy)piperidine |
| SMILES | COc1ccc(CCN2CCC[C@@H](OC3c4ccccc4C=Cc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C29H31NO2/c1-31-25-16-12-22(13-17-25)18-20-30-19-6-9-26(21-30)32-29-27-10-4-2-7-23(27)14-15-24-8-3-5-11-28(24)29/h2-5,7-8,10-17,26,29H,6,9,18-21H2,1H3/t26-/m1/s1 |
| InChIKey | OZJWAXWEHIEHJP-AREMUKBSSA-N |
| XLogP | 5.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|