About 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine
3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (PubChem CID 54177557) has the molecular formula C8H10FNS
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
| PubChem CID | 54177557 |
| Molecular Formula | C8H10FNS |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
| SMILES | NC1SC2C=CC=CC2C1F |
| InChI | InChI=1S/C8H10FNS/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-8H,10H2 |
| InChIKey | BUTUFNQQRDEAJP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (CID 54177557) is 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is NC1SC2C=CC=CC2C1F.
What is the InChIKey of 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is BUTUFNQQRDEAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNS/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-8H,10H2.
What are the key properties of 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine?
3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 171.24 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 54177557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).