C14H22N6S — CID 54177735
8-N,8-N-diethyl-5-N,5-N-dimethyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-5,8-diamine (PubChem CID 54177735) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is 8-N,8-N-diethyl-5-N,5-N-dimethyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-5,8-diamine.
| Compound Name | 8-N,8-N-diethyl-5-N,5-N-dimethyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-5,8-diamine |
|---|---|
| PubChem CID | 54177735 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 8-N,8-N-diethyl-5-N,5-N-dimethyl-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-5,8-diamine |
| SMILES | CCN(CC)c1c2c(nc3nc(N(C)C)nn13)CCCS2 |
| InChI | InChI=1S/C14H22N6S/c1-5-19(6-2)12-11-10(8-7-9-21-11)15-13-16-14(18(3)4)17-20(12)13/h5-9H2,1-4H3 |
| InChIKey | OZPRLAKAKVZCDN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |