About 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate
1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate (PubChem CID 54178196) has the molecular formula C29H29N3O3
and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate.
Molecular Properties
| Compound Name | 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate |
| PubChem CID | 54178196 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate |
| SMILES | CCC(OC(=O)c1ccc(CN(C)C)cc1)c1cc2n(c(=O)c1C)Cc1cc3ccccc3nc1-2 |
| InChI | InChI=1S/C29H29N3O3/c1-5-26(35-29(34)20-12-10-19(11-13-20)16-31(3)4)23-15-25-27-22(17-32(25)28(33)18(23)2)14-21-8-6-7-9-24(21)30-27/h6-15,26H,5,16-17H2,1-4H3 |
| InChIKey | OZXUAXMPTKVOSJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate?
The IUPAC name of 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate (CID 54178196) is 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate.
What is the SMILES notation for 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate?
The canonical SMILES for 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate is CCC(OC(=O)c1ccc(CN(C)C)cc1)c1cc2n(c(=O)c1C)Cc1cc3ccccc3nc1-2.
What is the InChIKey of 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate?
The InChIKey is OZXUAXMPTKVOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29N3O3/c1-5-26(35-29(34)20-12-10-19(11-13-20)16-31(3)4)23-15-25-27-22(17-32(25)28(33)18(23)2)14-21-8-6-7-9-24(21)30-27/h6-15,26H,5,16-17H2,1-4H3.
What are the key properties of 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate?
1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate has a molecular weight of 467.57 g/mol, XLogP of 5.10, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-methyl-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl)propyl 4-[(dimethylamino)methyl]benzoate is sourced from PubChem (CID 54178196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).