C9H8F12 — CID 54178514
1,1,1-trifluoro-2,2,3-tris(trifluoromethyl)hexane (PubChem CID 54178514) has the molecular formula C9H8F12 and a molecular weight of 344.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2,3-tris(trifluoromethyl)hexane.
| Compound Name | 1,1,1-trifluoro-2,2,3-tris(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 54178514 |
| Molecular Formula | C9H8F12 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1,1,1-trifluoro-2,2,3-tris(trifluoromethyl)hexane |
| SMILES | CCCC(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F12/c1-2-3-4(6(10,11)12)5(7(13,14)15,8(16,17)18)9(19,20)21/h4H,2-3H2,1H3 |
| InChIKey | PADLLUUIRLTBKB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |