About N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine
N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine (PubChem CID 54178731) has the molecular formula C6H10N2S3
and a molecular weight of 206.36 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine |
| PubChem CID | 54178731 |
| Molecular Formula | C6H10N2S3 |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine |
| SMILES | CSC(=NC1=NCCS1)SC |
| InChI | InChI=1S/C6H10N2S3/c1-9-6(10-2)8-5-7-3-4-11-5/h3-4H2,1-2H3 |
| InChIKey | PAHBLSRQJYAHSM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine?
The IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine (CID 54178731) is N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine.
What is the SMILES notation for N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine?
The canonical SMILES for N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine is CSC(=NC1=NCCS1)SC.
What is the InChIKey of N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine?
The InChIKey is PAHBLSRQJYAHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S3/c1-9-6(10-2)8-5-7-3-4-11-5/h3-4H2,1-2H3.
What are the key properties of N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine?
N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine has a molecular weight of 206.36 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1,3-thiazol-2-yl)-1,1-bis(methylsulfanyl)methanimine is sourced from PubChem (CID 54178731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).