C21H33NO5 — CID 54178740
(1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-propoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-phenyl-2-(propan-2-ylamino)ethanol (PubChem CID 54178740) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-propoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-phenyl-2-(propan-2-ylamino)ethanol.
| Compound Name | (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-propoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-phenyl-2-(propan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 54178740 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (1S)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-propoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-phenyl-2-(propan-2-ylamino)ethanol |
| SMILES | CCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](O)C(NC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H33NO5/c1-6-12-24-18-17(25-20-19(18)26-21(4,5)27-20)16(23)15(22-13(2)3)14-10-8-7-9-11-14/h7-11,13,15-20,22-23H,6,12H2,1-5H3/t15?,16-,17+,18-,19+,20+/m0/s1 |
| InChIKey | PAHFNYBZYKNBGI-MAYZUUGSSA-N |
| XLogP | 2.76 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |