About 1H-phthalazin-2-amine
1H-phthalazin-2-amine (PubChem CID 54178795) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1H-phthalazin-2-amine.
Molecular Properties
| Compound Name | 1H-phthalazin-2-amine |
| PubChem CID | 54178795 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1H-phthalazin-2-amine |
| SMILES | NN1Cc2ccccc2C=N1 |
| InChI | InChI=1S/C8H9N3/c9-11-6-8-4-2-1-3-7(8)5-10-11/h1-5H,6,9H2 |
| InChIKey | IPXQYWXDHMSUOX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1H-phthalazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phthalazin-2-amine?
The IUPAC name of 1H-phthalazin-2-amine (CID 54178795) is 1H-phthalazin-2-amine.
What is the SMILES notation for 1H-phthalazin-2-amine?
The canonical SMILES for 1H-phthalazin-2-amine is NN1Cc2ccccc2C=N1.
What is the InChIKey of 1H-phthalazin-2-amine?
The InChIKey is IPXQYWXDHMSUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c9-11-6-8-4-2-1-3-7(8)5-10-11/h1-5H,6,9H2.
What are the key properties of 1H-phthalazin-2-amine?
1H-phthalazin-2-amine has a molecular weight of 147.18 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phthalazin-2-amine is sourced from PubChem (CID 54178795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).