About 3-propoxy-1H-indol-2-ol
3-propoxy-1H-indol-2-ol (PubChem CID 54179450) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-propoxy-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-propoxy-1H-indol-2-ol |
| PubChem CID | 54179450 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-propoxy-1H-indol-2-ol |
| SMILES | CCCOc1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C11H13NO2/c1-2-7-14-10-8-5-3-4-6-9(8)12-11(10)13/h3-6,12-13H,2,7H2,1H3 |
| InChIKey | VKNSLGDMLTXJLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propoxy-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxy-1H-indol-2-ol?
The IUPAC name of 3-propoxy-1H-indol-2-ol (CID 54179450) is 3-propoxy-1H-indol-2-ol.
What is the SMILES notation for 3-propoxy-1H-indol-2-ol?
The canonical SMILES for 3-propoxy-1H-indol-2-ol is CCCOc1c(O)[nH]c2ccccc12.
What is the InChIKey of 3-propoxy-1H-indol-2-ol?
The InChIKey is VKNSLGDMLTXJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-7-14-10-8-5-3-4-6-9(8)12-11(10)13/h3-6,12-13H,2,7H2,1H3.
What are the key properties of 3-propoxy-1H-indol-2-ol?
3-propoxy-1H-indol-2-ol has a molecular weight of 191.23 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxy-1H-indol-2-ol is sourced from PubChem (CID 54179450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).