About 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride
4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride (PubChem CID 54179452) has the molecular formula C7H5ClO3S
and a molecular weight of 204.63 g/mol. Its IUPAC name is 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride |
| PubChem CID | 54179452 |
| Molecular Formula | C7H5ClO3S |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1=CCC(=S(=O)=O)C=C1 |
| InChI | InChI=1S/C7H5ClO3S/c8-7(9)5-1-3-6(4-2-5)12(10)11/h1-3H,4H2 |
| InChIKey | PATULTXBGPQXAI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride?
The IUPAC name of 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride (CID 54179452) is 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride.
What is the SMILES notation for 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride?
The canonical SMILES for 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride is O=C(Cl)C1=CCC(=S(=O)=O)C=C1.
What is the InChIKey of 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride?
The InChIKey is PATULTXBGPQXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO3S/c8-7(9)5-1-3-6(4-2-5)12(10)11/h1-3H,4H2.
What are the key properties of 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride?
4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride has a molecular weight of 204.63 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfonylcyclohexa-1,5-diene-1-carbonyl chloride is sourced from PubChem (CID 54179452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).