About prenylsilane
prenylsilane (PubChem CID 54179664) has the molecular formula C5H9Si
and a molecular weight of 97.21 g/mol.
Molecular Properties
| Compound Name | prenylsilane |
| PubChem CID | 54179664 |
| Molecular Formula | C5H9Si |
| Molecular Weight | 97.21 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | — |
| SMILES | CC(C)=CC[Si] |
| InChI | InChI=1S/C5H9Si/c1-5(2)3-4-6/h3H,4H2,1-2H3 |
| InChIKey | PAXJAZLKFLUUIW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prenylsilane?
The IUPAC name of prenylsilane (CID 54179664) is not available.
What is the SMILES notation for prenylsilane?
The canonical SMILES for prenylsilane is CC(C)=CC[Si].
What is the InChIKey of prenylsilane?
The InChIKey is PAXJAZLKFLUUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Si/c1-5(2)3-4-6/h3H,4H2,1-2H3.
What are the key properties of prenylsilane?
prenylsilane has a molecular weight of 97.21 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prenylsilane is sourced from PubChem (CID 54179664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).