About 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one
7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one (PubChem CID 5418018) has the molecular formula C14H8F3NO3S
and a molecular weight of 327.28 g/mol. Its IUPAC name is 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one.
Molecular Properties
| Compound Name | 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one |
| PubChem CID | 5418018 |
| Molecular Formula | C14H8F3NO3S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1csc(-c2c(C(F)(F)F)oc3cc(O)ccc3c2=O)n1 |
| InChI | InChI=1S/C14H8F3NO3S/c1-6-5-22-13(18-6)10-11(20)8-3-2-7(19)4-9(8)21-12(10)14(15,16)17/h2-5,19H,1H3 |
| InChIKey | AECARRZTFMQRBY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one?
The IUPAC name of 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one (CID 5418018) is 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one.
What is the SMILES notation for 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one?
The canonical SMILES for 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one is Cc1csc(-c2c(C(F)(F)F)oc3cc(O)ccc3c2=O)n1.
What is the InChIKey of 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one?
The InChIKey is AECARRZTFMQRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3NO3S/c1-6-5-22-13(18-6)10-11(20)8-3-2-7(19)4-9(8)21-12(10)14(15,16)17/h2-5,19H,1H3.
What are the key properties of 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one?
7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one has a molecular weight of 327.28 g/mol, XLogP of 3.95, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)chromen-4-one is sourced from PubChem (CID 5418018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).