About 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one
3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one (PubChem CID 54180760) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one |
| PubChem CID | 54180760 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one |
| SMILES | CC1=NC(C)CNC1=O |
| InChI | InChI=1S/C6H10N2O/c1-4-3-7-6(9)5(2)8-4/h4H,3H2,1-2H3,(H,7,9) |
| InChIKey | PBPVJJNHZMSEPN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one?
The IUPAC name of 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one (CID 54180760) is 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one.
What is the SMILES notation for 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one?
The canonical SMILES for 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one is CC1=NC(C)CNC1=O.
What is the InChIKey of 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one?
The InChIKey is PBPVJJNHZMSEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4-3-7-6(9)5(2)8-4/h4H,3H2,1-2H3,(H,7,9).
What are the key properties of 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one?
3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one has a molecular weight of 126.16 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2,3-dihydro-1H-pyrazin-6-one is sourced from PubChem (CID 54180760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).