C18H33FO4 — CID 54180804
2-fluoro-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyhexyl)cyclopentyl]heptanoic acid (PubChem CID 54180804) has the molecular formula C18H33FO4 and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-fluoro-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyhexyl)cyclopentyl]heptanoic acid.
| Compound Name | 2-fluoro-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyhexyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54180804 |
| Molecular Formula | C18H33FO4 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 2-fluoro-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyhexyl)cyclopentyl]heptanoic acid |
| SMILES | CCCC(O)CC[C@H]1CC[C@H](O)[C@@H]1CCCCCC(F)C(=O)O |
| InChI | InChI=1S/C18H33FO4/c1-2-6-14(20)11-9-13-10-12-17(21)15(13)7-4-3-5-8-16(19)18(22)23/h13-17,20-21H,2-12H2,1H3,(H,22,23)/t13-,14?,15+,16?,17-/m0/s1 |
| InChIKey | PBQRIFDOGPTCLM-VMNICZJSSA-N |
| XLogP | 3.69 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|