About 3-propylnonanal
3-propylnonanal (PubChem CID 54180960) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-propylnonanal.
Molecular Properties
| Compound Name | 3-propylnonanal |
| PubChem CID | 54180960 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-propylnonanal |
| SMILES | CCCCCCC(CC=O)CCC |
| InChI | InChI=1S/C12H24O/c1-3-5-6-7-9-12(8-4-2)10-11-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | PBTGVJPOMAQWCT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylnonanal?
The IUPAC name of 3-propylnonanal (CID 54180960) is 3-propylnonanal.
What is the SMILES notation for 3-propylnonanal?
The canonical SMILES for 3-propylnonanal is CCCCCCC(CC=O)CCC.
What is the InChIKey of 3-propylnonanal?
The InChIKey is PBTGVJPOMAQWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-3-5-6-7-9-12(8-4-2)10-11-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 3-propylnonanal?
3-propylnonanal has a molecular weight of 184.32 g/mol, XLogP of 3.96, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylnonanal is sourced from PubChem (CID 54180960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).