About N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide
N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 54181109) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide |
| PubChem CID | 54181109 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCN(CCC)C(=O)Cc1nncs1 |
| InChI | InChI=1S/C10H17N3OS/c1-3-5-13(6-4-2)10(14)7-9-12-11-8-15-9/h8H,3-7H2,1-2H3 |
| InChIKey | HJVKFBFQFGUAHR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The IUPAC name of N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide (CID 54181109) is N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide.
What is the SMILES notation for N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The canonical SMILES for N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide is CCCN(CCC)C(=O)Cc1nncs1.
What is the InChIKey of N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The InChIKey is HJVKFBFQFGUAHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-3-5-13(6-4-2)10(14)7-9-12-11-8-15-9/h8H,3-7H2,1-2H3.
What are the key properties of N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide has a molecular weight of 227.33 g/mol, XLogP of 1.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropyl-2-(1,3,4-thiadiazol-2-yl)acetamide is sourced from PubChem (CID 54181109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).