C10H16F5NS — CID 54181494
(2R)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine (PubChem CID 54181494) has the molecular formula C10H16F5NS and a molecular weight of 277.30 g/mol. Its IUPAC name is (2R)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine.
| Compound Name | (2R)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 54181494 |
| Molecular Formula | C10H16F5NS |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (2R)-2-(4,4,5,5,5-pentafluoropentylsulfanylmethyl)pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)CCCSC[C@H]1CCCN1 |
| InChI | InChI=1S/C10H16F5NS/c11-9(12,10(13,14)15)4-2-6-17-7-8-3-1-5-16-8/h8,16H,1-7H2/t8-/m1/s1 |
| InChIKey | PCCWBPBISLLZHG-MRVPVSSYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|