C20H28O2 — CID 54181524
(8S,13S,14S)-2-(methoxymethyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 54181524) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (8S,13S,14S)-2-(methoxymethyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S)-2-(methoxymethyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54181524 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (8S,13S,14S)-2-(methoxymethyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COCC1CC2=C3CC[C@]4(C)CCC[C@H]4[C@@H]3CCC2=CC1=O |
| InChI | InChI=1S/C20H28O2/c1-20-8-3-4-18(20)16-6-5-13-11-19(21)14(12-22-2)10-17(13)15(16)7-9-20/h11,14,16,18H,3-10,12H2,1-2H3/t14?,16-,18+,20+/m1/s1 |
| InChIKey | PCDJKNXXUFNKFP-CYEDPDBVSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |