C22H36 — CID 54181642
propane;1,2,3,5-tetramethyl-4-[(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene (PubChem CID 54181642) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is propane;1,2,3,5-tetramethyl-4-[(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene.
| Compound Name | propane;1,2,3,5-tetramethyl-4-[(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 54181642 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | propane;1,2,3,5-tetramethyl-4-[(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methyl]cyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)C(CC2=C(C)C(C)=C(C)C2C)=C1C.CCC |
| InChI | InChI=1S/C19H28.C3H8/c1-10-11(2)15(6)18(14(10)5)9-19-16(7)12(3)13(4)17(19)8;1-3-2/h14,16H,9H2,1-8H3;3H2,1-2H3 |
| InChIKey | PCFHKDXOZDFHBZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |