C21H18ClF4NO — CID 54182136
(4aR,10bR)-8-(4-chloro-2,3,5,6-tetrafluorophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 54182136) has the molecular formula C21H18ClF4NO and a molecular weight of 411.83 g/mol. Its IUPAC name is (4aR,10bR)-8-(4-chloro-2,3,5,6-tetrafluorophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-8-(4-chloro-2,3,5,6-tetrafluorophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54182136 |
| Molecular Formula | C21H18ClF4NO |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (4aR,10bR)-8-(4-chloro-2,3,5,6-tetrafluorophenyl)-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@]2(C)c3ccc(-c4c(F)c(F)c(Cl)c(F)c4F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C21H18ClF4NO/c1-21-8-7-14(28)27(2)13(21)6-4-10-9-11(3-5-12(10)21)15-17(23)19(25)16(22)20(26)18(15)24/h3,5,9,13H,4,6-8H2,1-2H3/t13-,21-/m1/s1 |
| InChIKey | PCNUCKIAVJMTPN-LRTDBIEQSA-N |
| XLogP | 5.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|