About 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol
8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol (PubChem CID 54182446) has the molecular formula C15H9Cl2NO2
and a molecular weight of 306.15 g/mol. Its IUPAC name is 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol.
Molecular Properties
| Compound Name | 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol |
| PubChem CID | 54182446 |
| Molecular Formula | C15H9Cl2NO2 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol |
| SMILES | Oc1ccc2cccc(Oc3ncc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C15H9Cl2NO2/c16-10-6-13(17)15(18-8-10)20-14-3-1-2-9-4-5-11(19)7-12(9)14/h1-8,19H |
| InChIKey | PCTTYVNJSORKKD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol?
The IUPAC name of 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol (CID 54182446) is 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol.
What is the SMILES notation for 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol?
The canonical SMILES for 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol is Oc1ccc2cccc(Oc3ncc(Cl)cc3Cl)c2c1.
What is the InChIKey of 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol?
The InChIKey is PCTTYVNJSORKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NO2/c16-10-6-13(17)15(18-8-10)20-14-3-1-2-9-4-5-11(19)7-12(9)14/h1-8,19H.
What are the key properties of 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol?
8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol has a molecular weight of 306.15 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3,5-dichloro-2-pyridinyl)oxy]naphthalen-2-ol is sourced from PubChem (CID 54182446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).