C23H22F2N4O — CID 54182810
1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 54182810) has the molecular formula C23H22F2N4O and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 54182810 |
| Molecular Formula | C23H22F2N4O |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1 |
| InChI | InChI=1S/C23H22F2N4O/c24-20-5-3-16(12-21(20)25)28-23(30)27-15-4-6-22-18(11-15)19(13-26-22)14-7-9-29-8-1-2-17(29)10-14/h3-7,11-13,17,26H,1-2,8-10H2,(H2,27,28,30) |
| InChIKey | PDADFAXMHYDNCY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |