C17H28O2 — CID 54182900
heptadeca-2,4,6-trienoic acid (PubChem CID 54182900) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is heptadeca-2,4,6-trienoic acid.
| Compound Name | heptadeca-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54182900 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | heptadeca-2,4,6-trienoic acid |
| SMILES | CCCCCCCCCCC=CC=CC=CC(=O)O |
| InChI | InChI=1S/C17H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h11-16H,2-10H2,1H3,(H,18,19) |
| InChIKey | PDCATFMXDGXATL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|