C34H31FN5O2S+ — CID 54183195
(1S)-1,3-dibenzyl-4-(4-fluorophenyl)sulfonyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-1-ium-7-carbonitrile (PubChem CID 54183195) has the molecular formula C34H31FN5O2S+ and a molecular weight of 592.72 g/mol. Its IUPAC name is (1S)-1,3-dibenzyl-4-(4-fluorophenyl)sulfonyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-1-ium-7-carbonitrile.
| Compound Name | (1S)-1,3-dibenzyl-4-(4-fluorophenyl)sulfonyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-1-ium-7-carbonitrile |
|---|---|
| PubChem CID | 54183195 |
| Molecular Formula | C34H31FN5O2S+ |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | (1S)-1,3-dibenzyl-4-(4-fluorophenyl)sulfonyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-1-ium-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CN(S(=O)(=O)c1ccc(F)cc1)C(Cc1ccccc1)C[N@@+]2(Cc1ccccc1)Cc1cnc[nH]1 |
| InChI | InChI=1S/C34H31FN5O2S/c35-30-12-14-33(15-13-30)43(41,42)39-21-29-17-28(19-36)11-16-34(29)40(23-31-20-37-25-38-31,22-27-9-5-2-6-10-27)24-32(39)18-26-7-3-1-4-8-26/h1-17,20,25,32H,18,21-24H2,(H,37,38)/q+1/t32?,40-/m1/s1 |
| InChIKey | AAZDGHDMTSYSQD-XJIPKEOCSA-N |
| XLogP | 5.94 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|