C18H23F5OS — CID 54183500
[4-[2-(4-butoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite (PubChem CID 54183500) has the molecular formula C18H23F5OS and a molecular weight of 382.44 g/mol. Its IUPAC name is [4-[2-(4-butoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite.
| Compound Name | [4-[2-(4-butoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 54183500 |
| Molecular Formula | C18H23F5OS |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [4-[2-(4-butoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite |
| SMILES | CCCCOC1CCC(C(F)(F)C(F)(F)c2ccc(SF)cc2)CC1 |
| InChI | InChI=1S/C18H23F5OS/c1-2-3-12-24-15-8-4-13(5-9-15)17(19,20)18(21,22)14-6-10-16(25-23)11-7-14/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3 |
| InChIKey | PDMYUGADGBSTPJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|