C30H35F5N4O4 — CID 54183554
N-[(2S)-3-methyl-2-(3-pyridin-3-ylpropanoylamino)butanoyl]-2-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 54183554) has the molecular formula C30H35F5N4O4 and a molecular weight of 610.62 g/mol. Its IUPAC name is N-[(2S)-3-methyl-2-(3-pyridin-3-ylpropanoylamino)butanoyl]-2-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[(2S)-3-methyl-2-(3-pyridin-3-ylpropanoylamino)butanoyl]-2-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54183554 |
| Molecular Formula | C30H35F5N4O4 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | N-[(2S)-3-methyl-2-(3-pyridin-3-ylpropanoylamino)butanoyl]-2-(5,5,6,6,6-pentafluoro-2-methyl-4-oxohexan-3-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)C(C(=O)C(F)(F)C(F)(F)F)N1Cc2ccccc2CC1C(=O)NC(=O)[C@@H](NC(=O)CCc1cccnc1)C(C)C |
| InChI | InChI=1S/C30H35F5N4O4/c1-17(2)24(37-23(40)12-11-19-8-7-13-36-15-19)28(43)38-27(42)22-14-20-9-5-6-10-21(20)16-39(22)25(18(3)4)26(41)29(31,32)30(33,34)35/h5-10,13,15,17-18,22,24-25H,11-12,14,16H2,1-4H3,(H,37,40)(H,38,42,43)/t22?,24-,25?/m0/s1 |
| InChIKey | PDNWPTYENJAZDA-JYNIAERNSA-N |
| XLogP | 4.02 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|