1-ethylcyclopropane-1-carbonyl chloride

C6H9ClO — CID 54183701

IUPAC1-ethylcyclopropane-1-carbonyl chloride
SMILESCCC1(C(=O)Cl)CC1
InChIInChI=1S/C6H9ClO/c1-2-6(3-4-6)5(7)8/h2-4H2,1H3
InChIKeyPDQQMDHQCMDAET-UHFFFAOYSA-N
MW132.59 g/mol
LogP1.94
Rot. Bonds2

About 1-ethylcyclopropane-1-carbonyl chloride

1-ethylcyclopropane-1-carbonyl chloride (PubChem CID 54183701) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is 1-ethylcyclopropane-1-carbonyl chloride.

Molecular Properties

Compound Name1-ethylcyclopropane-1-carbonyl chloride
PubChem CID54183701
Molecular FormulaC6H9ClO
Molecular Weight132.59 g/mol
Exact Mass132.03
IUPAC Name1-ethylcyclopropane-1-carbonyl chloride
SMILESCCC1(C(=O)Cl)CC1
InChIInChI=1S/C6H9ClO/c1-2-6(3-4-6)5(7)8/h2-4H2,1H3
InChIKeyPDQQMDHQCMDAET-UHFFFAOYSA-N
XLogP1.94
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.59
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-ethylcyclopropane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethylcyclopropane-1-carbonyl chloride?
The IUPAC name of 1-ethylcyclopropane-1-carbonyl chloride (CID 54183701) is 1-ethylcyclopropane-1-carbonyl chloride.
What is the SMILES notation for 1-ethylcyclopropane-1-carbonyl chloride?
The canonical SMILES for 1-ethylcyclopropane-1-carbonyl chloride is CCC1(C(=O)Cl)CC1.
What is the InChIKey of 1-ethylcyclopropane-1-carbonyl chloride?
The InChIKey is PDQQMDHQCMDAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO/c1-2-6(3-4-6)5(7)8/h2-4H2,1H3.
What are the key properties of 1-ethylcyclopropane-1-carbonyl chloride?
1-ethylcyclopropane-1-carbonyl chloride has a molecular weight of 132.59 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylcyclopropane-1-carbonyl chloride is sourced from PubChem (CID 54183701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).