About 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole
3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole (PubChem CID 54184168) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole.
Analyze 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole?
The IUPAC name of 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole (CID 54184168) is 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole.
What is the SMILES notation for 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole?
The canonical SMILES for 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole is C1CC2CNCC2O1.
What is the InChIKey of 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole?
The InChIKey is KUQSQOIIMSDGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-2-8-6-4-7-3-5(1)6/h5-7H,1-4H2.
What are the key properties of 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole?
3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole has a molecular weight of 113.16 g/mol, XLogP of -0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole is sourced from PubChem (CID 54184168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).