C25H38N2O2 — CID 54184331
N-(5-amino-6-oxohexyl)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 54184331) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-(5-amino-6-oxohexyl)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | N-(5-amino-6-oxohexyl)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 54184331 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-(5-amino-6-oxohexyl)-9-(6,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=CCCCC1(C)C)=CC=CC(C)=CC(=O)NCCCCC(N)C=O |
| InChI | InChI=1S/C25H38N2O2/c1-20(14-15-22-12-5-7-16-25(22,3)4)10-9-11-21(2)18-24(29)27-17-8-6-13-23(26)19-28/h9-12,14-15,18-19,23H,5-8,13,16-17,26H2,1-4H3,(H,27,29) |
| InChIKey | PEAVVLDJGXTADW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|