About 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid
5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid (PubChem CID 54184574) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid.
Molecular Properties
| Compound Name | 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid |
| PubChem CID | 54184574 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid |
| SMILES | CC=CC(C=CC)(CCC(O)CC)C(=O)O |
| InChI | InChI=1S/C13H22O3/c1-4-8-13(9-5-2,12(15)16)10-7-11(14)6-3/h4-5,8-9,11,14H,6-7,10H2,1-3H3,(H,15,16) |
| InChIKey | PEESUJTZYIBBAO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid?
The IUPAC name of 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid (CID 54184574) is 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid.
What is the SMILES notation for 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid?
The canonical SMILES for 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid is CC=CC(C=CC)(CCC(O)CC)C(=O)O.
What is the InChIKey of 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid?
The InChIKey is PEESUJTZYIBBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-4-8-13(9-5-2,12(15)16)10-7-11(14)6-3/h4-5,8-9,11,14H,6-7,10H2,1-3H3,(H,15,16).
What are the key properties of 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid?
5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid has a molecular weight of 226.32 g/mol, XLogP of 2.76, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2-bis(prop-1-enyl)heptanoic acid is sourced from PubChem (CID 54184574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).